feat: Add Improved Polish Orthophoto Map component with WMTS support

- Introduced ImprovedPolishOrthophotoMap component for displaying Polish orthophoto layers using WMTS. - Implemented custom WMTSLayer for handling tile requests. - Added Google Satellite and OpenStreetMap layers for comparison. - Included debug information for network requests to Geoportal. - Enhanced LeafletMap to support WMS overlays and improved layer control. - Created PolishGeoLayers module for easy access to various Polish geospatial layers. - Added TransparencyDemoMap for adjustable layer opacity controls. - Updated mapLayers configuration to include new Polish orthophoto layers and WMS overlays. - Refactored wmtsCapabilities to use updated URLs and parameters for better compatibility.
2025-06-21 01:21:21 +02:00
parent 6df4302396
commit f83cc8e564
25 changed files with 4538 additions and 32 deletions
--- a/src/components/ui/AdvancedPolishOrthophotoMap.js
+++ b/src/components/ui/AdvancedPolishOrthophotoMap.js
@@ -0,0 +1,254 @@
+"use client";
+
+import { MapContainer, TileLayer, WMSTileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
+import 'leaflet/dist/leaflet.css';
+import { useEffect, useState } from 'react';
+import proj4 from 'proj4';
+
+// Define Polish coordinate system EPSG:2180
+proj4.defs("EPSG:2180", "+proj=tmerc +lat_0=0 +lon_0=19 +k=0.9993 +x_0=500000 +y_0=-5300000 +ellps=GRS80 +towgs84=0,0,0,0,0,0,0 +units=m +no_defs +type=crs");
+
+// Fix for default markers in react-leaflet
+const fixLeafletIcons = () => {
+  if (typeof window !== 'undefined') {
+    const L = require('leaflet');
+    
+    delete L.Icon.Default.prototype._getIconUrl;
+    L.Icon.Default.mergeOptions({
+      iconRetinaUrl: '/leaflet/marker-icon-2x.png',
+      iconUrl: '/leaflet/marker-icon.png',
+      shadowUrl: '/leaflet/marker-shadow.png',
+    });
+  }
+};
+
+// Polish Geoportal Orthophoto - Standard Resolution
+function PolishOrthophotoStandardLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+// Polish Geoportal Orthophoto - High Resolution
+function PolishOrthophotoHighResLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/HighResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+// Polish Land Records (Cadastral) - using WMS
+function PolishCadastralLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://www.gugik.gov.pl/">GUGiK</a>'
+      url="https://integracja01.gugik.gov.pl/cgi-bin/KrajowaIntegracjaEwidencjiGruntow"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'powiaty,powiaty_obreby,zsin,obreby,dzialki,geoportal,numery_dzialek,budynki',
+        styles: ',,,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256
+      }}
+      format="image/png"
+      transparent={true}
+    />
+  );
+}
+
+// Polish Spatial Planning (MPZT) - WMS
+function PolishSpatialPlanningLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/ext/KrajowaIntegracjaMiejscowychPlanowZagospodarowaniaPrzestrzennego"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'raster,wektor-str,wektor-lzb,wektor-pow,wektor-lin,wektor-pkt,granice',
+        styles: ',,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256
+      }}
+      format="image/png"
+      transparent={true}
+    />
+  );
+}
+
+// LP-Portal Roads Layer
+function LPPortalRoadsLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_6_mapainteraktywna_drogi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+    />
+  );
+}
+
+// LP-Portal Street Names Layer
+function LPPortalStreetNamesLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_5_mapainteraktywna_opisy_drog,00_3_mapainteraktywna_nazwy_ulic',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+    />
+  );
+}
+
+// Google Maps layers
+function GoogleSatelliteLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+function GoogleRoadsLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=h&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+export default function AdvancedPolishOrthophotoMap({ 
+  center = [50.0647, 19.9450], // Default to Krakow, Poland
+  zoom = 13, 
+  markers = [], 
+  showLayerControl = true 
+}) {
+  const [mapLoaded, setMapLoaded] = useState(false);
+
+  useEffect(() => {
+    fixLeafletIcons();
+    setMapLoaded(true);
+  }, []);
+
+  const { BaseLayer, Overlay } = LayersControl;
+
+  if (!mapLoaded) {
+    return <div>Loading map...</div>;
+  }
+
+  return (
+    <MapContainer 
+      center={center} 
+      zoom={zoom} 
+      style={{ height: '100%', width: '100%' }}
+      scrollWheelZoom={true}
+    >
+      {showLayerControl ? (
+        <LayersControl position="topright">
+          {/* Base Layers */}
+          <BaseLayer name="OpenStreetMap">
+            <TileLayer
+              attribution='&copy; <a href="https://www.openstreetmap.org/copyright">OpenStreetMap</a> contributors'
+              url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
+              maxZoom={19}
+            />
+          </BaseLayer>
+          
+          <BaseLayer checked name="Polish Geoportal Orthophoto (Standard)">
+            <PolishOrthophotoStandardLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Polish Geoportal Orthophoto (High Resolution)">
+            <PolishOrthophotoHighResLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Satellite">
+            <GoogleSatelliteLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Roads">
+            <GoogleRoadsLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Esri Satellite">
+            <TileLayer
+              attribution='&copy; <a href="https://www.esri.com/">Esri</a> &mdash; Source: Esri, i-cubed, USDA, USGS, AEX, GeoEye, Getmapping, Aerogrid, IGN, IGP, UPR-EGP, and the GIS User Community'
+              url="https://server.arcgisonline.com/ArcGIS/rest/services/World_Imagery/MapServer/tile/{z}/{y}/{x}"
+              maxZoom={19}
+            />
+          </BaseLayer>          {/* Overlay Layers */}
+          <Overlay name="📋 Polish Cadastral Data (Działki)">
+            <PolishCadastralLayer />
+          </Overlay>
+
+          <Overlay name="🏗️ Polish Spatial Planning (MPZT)">
+            <PolishSpatialPlanningLayer />
+          </Overlay>
+
+          <Overlay name="🛣️ LP-Portal Roads">
+            <LPPortalRoadsLayer />
+          </Overlay>
+
+          <Overlay name="🏷️ LP-Portal Street Names">
+            <LPPortalStreetNamesLayer />
+          </Overlay>
+        </LayersControl>
+      ) : (
+        // Default to Polish orthophoto when no layer control
+        <PolishOrthophotoStandardLayer />
+      )}
+
+      {markers.map((marker, index) => (
+        <Marker key={index} position={marker.position}>
+          {marker.popup && <Popup>{marker.popup}</Popup>}
+        </Marker>
+      ))}
+    </MapContainer>
+  );
+}
--- a/src/components/ui/ComprehensivePolishMap.js
+++ b/src/components/ui/ComprehensivePolishMap.js
@@ -0,0 +1,322 @@
+"use client";
+
+import { MapContainer, TileLayer, WMSTileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
+import 'leaflet/dist/leaflet.css';
+import { useEffect, useState } from 'react';
+import proj4 from 'proj4';
+
+// Define Polish coordinate system EPSG:2180
+proj4.defs("EPSG:2180", "+proj=tmerc +lat_0=0 +lon_0=19 +k=0.9993 +x_0=500000 +y_0=-5300000 +ellps=GRS80 +towgs84=0,0,0,0,0,0,0 +units=m +no_defs +type=crs");
+
+// Fix for default markers in react-leaflet
+const fixLeafletIcons = () => {
+  if (typeof window !== 'undefined') {
+    const L = require('leaflet');
+    
+    delete L.Icon.Default.prototype._getIconUrl;
+    L.Icon.Default.mergeOptions({
+      iconRetinaUrl: '/leaflet/marker-icon-2x.png',
+      iconUrl: '/leaflet/marker-icon.png',
+      shadowUrl: '/leaflet/marker-shadow.png',
+    });
+  }
+};
+
+// 1. Polish Geoportal Orthophoto - Standard Resolution
+function PolishOrthophotoStandardLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+// 2. Polish Geoportal Orthophoto - High Resolution
+function PolishOrthophotoHighResLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/HighResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+// 3. Polish Cadastral Data (Działki) - WMS Transparent Overlay
+function PolishCadastralLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://www.gugik.gov.pl/">GUGiK</a>'
+      url="https://integracja01.gugik.gov.pl/cgi-bin/KrajowaIntegracjaEwidencjiGruntow"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'powiaty,powiaty_obreby,zsin,obreby,dzialki,geoportal,numery_dzialek,budynki',
+        styles: ',,,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256
+      }}
+      format="image/png"
+      transparent={true}
+      opacity={0.8} // Semi-transparent for overlay
+    />
+  );
+}
+
+// 4. Polish Spatial Planning (MPZT) - WMS Transparent Overlay
+function PolishSpatialPlanningLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/ext/KrajowaIntegracjaMiejscowychPlanowZagospodarowaniaPrzestrzennego"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'raster,wektor-str,wektor-lzb,wektor-pow,wektor-lin,wektor-pkt,granice',
+        styles: ',,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png"
+      transparent={true}
+      opacity={0.7} // Semi-transparent for overlay
+    />
+  );
+}
+
+// 5. LP-Portal Roads Layer - Transparent Overlay
+function LPPortalRoadsLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_6_mapainteraktywna_drogi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+      opacity={0.9} // Mostly opaque for roads
+    />
+  );
+}
+
+// 6. LP-Portal Street Names Layer - Transparent Overlay
+function LPPortalStreetNamesLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_5_mapainteraktywna_opisy_drog,00_3_mapainteraktywna_nazwy_ulic',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+      opacity={1.0} // Fully opaque for text labels
+    />
+  );
+}
+
+// 7. LP-Portal Property Parcels (Działki) - Transparent Overlay
+function LPPortalParcelsLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'dzialki',
+        styles: '',
+        format: 'image/png',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png"
+      transparent={true}
+      opacity={0.6} // Semi-transparent for property boundaries
+    />
+  );
+}
+
+// 8. LP-Portal Survey Markers (Pikietarz) - Transparent Overlay
+function LPPortalSurveyMarkersLayer() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_2_view_geop_odcinek_pikietaz_glob_multi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        width: 256,
+        height: 256,
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+      opacity={0.8} // Semi-transparent for survey markers
+    />
+  );
+}
+
+// Google Maps layers for comparison
+function GoogleSatelliteLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+function GoogleRoadsLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=h&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+export default function ComprehensivePolishMap({ 
+  center = [50.0647, 19.9450], // Default to Krakow, Poland
+  zoom = 13, 
+  markers = [], 
+  showLayerControl = true 
+}) {
+  const [mapLoaded, setMapLoaded] = useState(false);
+
+  useEffect(() => {
+    fixLeafletIcons();
+    setMapLoaded(true);
+  }, []);
+
+  const { BaseLayer, Overlay } = LayersControl;
+
+  if (!mapLoaded) {
+    return <div>Loading comprehensive Polish map...</div>;
+  }
+
+  return (
+    <MapContainer 
+      center={center} 
+      zoom={zoom} 
+      style={{ height: '100%', width: '100%' }}
+      scrollWheelZoom={true}
+    >
+      {showLayerControl ? (
+        <LayersControl position="topright">
+          {/* Base Layers */}
+          <BaseLayer name="OpenStreetMap">
+            <TileLayer
+              attribution='&copy; <a href="https://www.openstreetmap.org/copyright">OpenStreetMap</a> contributors'
+              url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
+              maxZoom={19}
+            />
+          </BaseLayer>
+          
+          <BaseLayer checked name="Polish Orthophoto (Standard)">
+            <PolishOrthophotoStandardLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Polish Orthophoto (High Resolution)">
+            <PolishOrthophotoHighResLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Satellite">
+            <GoogleSatelliteLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Roads">
+            <GoogleRoadsLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Esri Satellite">
+            <TileLayer
+              attribution='&copy; <a href="https://www.esri.com/">Esri</a> &mdash; Source: Esri, i-cubed, USDA, USGS, AEX, GeoEye, Getmapping, Aerogrid, IGN, IGP, UPR-EGP, and the GIS User Community'
+              url="https://server.arcgisonline.com/ArcGIS/rest/services/World_Imagery/MapServer/tile/{z}/{y}/{x}"
+              maxZoom={19}
+            />
+          </BaseLayer>
+
+          {/* Polish Government Overlay Layers */}
+          <Overlay name="📋 Polish Cadastral Data (Działki)">
+            <PolishCadastralLayer />
+          </Overlay>
+
+          <Overlay name="🏗️ Polish Spatial Planning (MPZT)">
+            <PolishSpatialPlanningLayer />
+          </Overlay>
+
+          {/* LP-Portal Overlay Layers */}
+          <Overlay name="🛣️ LP-Portal Roads">
+            <LPPortalRoadsLayer />
+          </Overlay>
+
+          <Overlay name="🏷️ LP-Portal Street Names">
+            <LPPortalStreetNamesLayer />
+          </Overlay>
+
+          <Overlay name="📐 LP-Portal Property Parcels">
+            <LPPortalParcelsLayer />
+          </Overlay>
+
+          <Overlay name="📍 LP-Portal Survey Markers">
+            <LPPortalSurveyMarkersLayer />
+          </Overlay>
+        </LayersControl>
+      ) : (
+        // Default to Polish orthophoto when no layer control
+        <PolishOrthophotoStandardLayer />
+      )}
+
+      {markers.map((marker, index) => (
+        <Marker key={index} position={marker.position}>
+          {marker.popup && <Popup>{marker.popup}</Popup>}
+        </Marker>
+      ))}
+    </MapContainer>
+  );
+}
--- a/src/components/ui/CustomWMTSMap.js
+++ b/src/components/ui/CustomWMTSMap.js
@@ -48,14 +48,13 @@ export default function CustomWMTSMap({ center, zoom = 13, markers = [] }) {
            url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
          />
        </BaseLayer>
-        
-        <BaseLayer name="Polish Geoportal ORTO (WMTS)">
-          <CustomWMTSLayer
-            url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution"
-            layer="ORTO"
-            style="default"
-            tilematrixSet="EPSG:3857"
-            format="image/jpeg"
+          <BaseLayer name="Polish Geoportal ORTO (Working)">
+          <TileLayer
+            attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+            url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/REST/StandardResolution/tile/{z}/{y}/{x}.png"
+            maxZoom={19}
+            tileSize={512}
+            zoomOffset={-1}
          />
        </BaseLayer>

--- a/src/components/ui/DebugPolishOrthophotoMap.js
+++ b/src/components/ui/DebugPolishOrthophotoMap.js
@@ -0,0 +1,213 @@
+"use client";
+
+import { MapContainer, TileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
+import 'leaflet/dist/leaflet.css';
+import { useEffect, useState } from 'react';
+import proj4 from 'proj4';
+
+// Define Polish coordinate system EPSG:2180 (from your OpenLayers code)
+proj4.defs("EPSG:2180", "+proj=tmerc +lat_0=0 +lon_0=19 +k=0.9993 +x_0=500000 +y_0=-5300000 +ellps=GRS80 +towgs84=0,0,0,0,0,0,0 +units=m +no_defs +type=crs");
+
+// Fix for default markers in react-leaflet
+const fixLeafletIcons = () => {
+  if (typeof window !== 'undefined') {
+    const L = require('leaflet');
+    
+    delete L.Icon.Default.prototype._getIconUrl;
+    L.Icon.Default.mergeOptions({
+      iconRetinaUrl: '/leaflet/marker-icon-2x.png',
+      iconUrl: '/leaflet/marker-icon.png',
+      shadowUrl: '/leaflet/marker-shadow.png',
+    });
+  }
+};
+
+// Multiple attempts at Polish Geoportal Orthophoto URLs
+function PolishOrthophotoOption1() {
+  console.log("Loading Polish Orthophoto Option 1: WMTS KVP Standard");
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a> (Option 1 - WMTS KVP)'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+function PolishOrthophotoOption2() {
+  console.log("Loading Polish Orthophoto Option 2: WMTS KVP with EPSG:2180");
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a> (Option 2 - WMTS EPSG:2180)'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:2180&TILEMATRIX=EPSG:2180:{z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={16}
+    />
+  );
+}
+
+function PolishOrthophotoOption3() {
+  console.log("Loading Polish Orthophoto Option 3: Alternative WMTS URL");
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a> (Option 3 - Alt WMTS)'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=GoogleMapsCompatible&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+function PolishOrthophotoOption4() {
+  console.log("Loading Polish Orthophoto Option 4: PNG format");
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a> (Option 4 - PNG)'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/png"
+      maxZoom={19}
+    />
+  );
+}
+
+// Working Google Maps layers for comparison
+function GoogleSatelliteLayer() {
+  console.log("Loading Google Satellite (known working)");
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+function GoogleRoadsLayer() {
+  console.log("Loading Google Roads (known working)");
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=h&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+export default function DebugPolishOrthophotoMap({ 
+  center = [50.0647, 19.9450], // Krakow, Poland
+  zoom = 13, 
+  markers = [] 
+}) {
+  const [mapLoaded, setMapLoaded] = useState(false);
+  const [debugInfo, setDebugInfo] = useState([]);
+
+  useEffect(() => {
+    fixLeafletIcons();
+    setMapLoaded(true);
+    
+    // Add debug logging
+    const originalFetch = window.fetch;
+    window.fetch = function(...args) {
+      const url = args[0];
+      if (typeof url === 'string' && url.includes('geoportal.gov.pl')) {
+        console.log('Geoportal request:', url);
+        setDebugInfo(prev => [...prev, `Request: ${url}`]);
+      }
+      return originalFetch.apply(this, args)
+        .then(response => {
+          if (typeof url === 'string' && url.includes('geoportal.gov.pl')) {
+            console.log('Geoportal response status:', response.status, 'for:', url);
+            setDebugInfo(prev => [...prev, `Response: ${response.status} for ${url}`]);
+          }
+          return response;
+        })
+        .catch(error => {
+          if (typeof url === 'string' && url.includes('geoportal.gov.pl')) {
+            console.error('Geoportal error:', error, 'for:', url);
+            setDebugInfo(prev => [...prev, `Error: ${error.message} for ${url}`]);
+          }
+          throw error;
+        });
+    };
+
+    return () => {
+      window.fetch = originalFetch;
+    };
+  }, []);
+
+  const { BaseLayer } = LayersControl;
+
+  if (!mapLoaded) {
+    return <div>Loading debug map...</div>;
+  }
+
+  return (
+    <div style={{ height: '100%', width: '100%' }}>
+      {/* Debug Info Panel */}
+      <div style={{ 
+        position: 'absolute', 
+        top: '10px', 
+        left: '10px', 
+        background: 'rgba(255,255,255,0.9)', 
+        padding: '10px', 
+        maxWidth: '300px', 
+        maxHeight: '200px', 
+        overflow: 'auto', 
+        zIndex: 1000,
+        fontSize: '12px',
+        borderRadius: '5px'
+      }}>
+        <strong>Debug Info:</strong>
+        {debugInfo.slice(-10).map((info, index) => (
+          <div key={index}>{info}</div>
+        ))}
+      </div>
+
+      <MapContainer 
+        center={center} 
+        zoom={zoom} 
+        style={{ height: '100%', width: '100%' }}
+        scrollWheelZoom={true}
+      >
+        <LayersControl position="topright">
+          {/* Working layers first for comparison */}
+          <BaseLayer checked name="Google Satellite (Working)">
+            <GoogleSatelliteLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Roads (Working)">
+            <GoogleRoadsLayer />
+          </BaseLayer>
+
+          <BaseLayer name="OpenStreetMap (Working)">
+            <TileLayer
+              attribution='&copy; <a href="https://www.openstreetmap.org/copyright">OpenStreetMap</a> contributors'
+              url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
+              maxZoom={19}
+            />
+          </BaseLayer>
+
+          {/* Different Polish Geoportal attempts */}
+          <BaseLayer name="Polish Ortho - Option 1 (REST Standard)">
+            <PolishOrthophotoOption1 />
+          </BaseLayer>
+
+          <BaseLayer name="Polish Ortho - Option 2 (XYZ Direct)">
+            <PolishOrthophotoOption2 />
+          </BaseLayer>
+
+          <BaseLayer name="Polish Ortho - Option 3 (WMTS)">
+            <PolishOrthophotoOption3 />
+          </BaseLayer>
+
+          <BaseLayer name="Polish Ortho - Option 4 (Alt REST)">
+            <PolishOrthophotoOption4 />
+          </BaseLayer>
+        </LayersControl>
+
+        {markers.map((marker, index) => (
+          <Marker key={index} position={marker.position}>
+            {marker.popup && <Popup>{marker.popup}</Popup>}
+          </Marker>
+        ))}
+      </MapContainer>
+    </div>
+  );
+}
--- a/src/components/ui/EnhancedLeafletMap.js
+++ b/src/components/ui/EnhancedLeafletMap.js
@@ -1,6 +1,6 @@
 "use client";

-import { MapContainer, TileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
+import { MapContainer, TileLayer, WMSTileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
 import 'leaflet/dist/leaflet.css';
 import { useEffect } from 'react';
 import { mapLayers } from './mapLayers';
@@ -29,8 +29,7 @@ export default function EnhancedLeafletMap({
  useEffect(() => {
    fixLeafletIcons();
  }, []);
-
-  const { BaseLayer } = LayersControl;
+  const { BaseLayer, Overlay } = LayersControl;

  return (
    <MapContainer 
@@ -41,6 +40,7 @@ export default function EnhancedLeafletMap({
    >
      {showLayerControl ? (
        <LayersControl position="topright">
+          {/* Base Layers */}
          {mapLayers.base.map((layer, index) => (
            <BaseLayer 
              key={index} 
@@ -55,6 +55,32 @@ export default function EnhancedLeafletMap({
              />
            </BaseLayer>
          ))}
+            {/* Overlay Layers */}
+          {mapLayers.overlays && mapLayers.overlays.map((layer, index) => (
+            <Overlay
+              key={`overlay-${index}`}
+              checked={layer.checked}
+              name={layer.name}
+            >
+              {layer.type === "wms" ? (
+                <WMSTileLayer
+                  attribution={layer.attribution}
+                  url={layer.url}
+                  params={layer.params}
+                  format={layer.params.format}
+                  transparent={layer.params.transparent}
+                  opacity={layer.opacity}
+                />
+              ) : (
+                <TileLayer
+                  attribution={layer.attribution}
+                  url={layer.url}
+                  maxZoom={layer.maxZoom}
+                  opacity={layer.opacity}
+                />
+              )}
+            </Overlay>
+          ))}
        </LayersControl>
      ) : (
        // Default layer when no layer control
--- a/src/components/ui/ImprovedPolishOrthophotoMap.js
+++ b/src/components/ui/ImprovedPolishOrthophotoMap.js
@@ -0,0 +1,167 @@
+"use client";
+
+import { MapContainer, TileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
+import 'leaflet/dist/leaflet.css';
+import { useEffect, useState } from 'react';
+import { WMTSLayer } from './WMTSLayer';
+
+// Fix for default markers in react-leaflet
+const fixLeafletIcons = () => {
+  if (typeof window !== 'undefined') {
+    const L = require('leaflet');
+    
+    delete L.Icon.Default.prototype._getIconUrl;
+    L.Icon.Default.mergeOptions({
+      iconRetinaUrl: '/leaflet/marker-icon-2x.png',
+      iconUrl: '/leaflet/marker-icon.png',
+      shadowUrl: '/leaflet/marker-shadow.png',
+    });
+  }
+};
+
+// Custom layer wrapper for WMTS
+function PolishWMTSLayer({ tilematrixSet = 'EPSG:3857', format = 'image/jpeg' }) {
+  return (
+    <WMTSLayer
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution"
+      layer="ORTO"
+      style="default"
+      tilematrixSet={tilematrixSet}
+      format={format}
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      maxZoom={19}
+    />
+  );
+}
+
+// Working Google Maps layers for comparison
+function GoogleSatelliteLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+export default function ImprovedPolishOrthophotoMap({ 
+  center = [50.0647, 19.9450], // Krakow, Poland
+  zoom = 13, 
+  markers = [] 
+}) {
+  const [mapLoaded, setMapLoaded] = useState(false);
+  const [debugInfo, setDebugInfo] = useState([]);
+
+  useEffect(() => {
+    fixLeafletIcons();
+    setMapLoaded(true);
+    
+    // Debug network requests
+    const originalFetch = window.fetch;
+    window.fetch = function(...args) {
+      const url = args[0];
+      if (typeof url === 'string' && url.includes('geoportal.gov.pl')) {
+        console.log('Geoportal WMTS request:', url);
+        setDebugInfo(prev => [...prev.slice(-5), `Request: ${url.split('?')[1]}`]);
+      }
+      return originalFetch.apply(this, args)
+        .then(response => {
+          if (typeof url === 'string' && url.includes('geoportal.gov.pl')) {
+            console.log('Geoportal response:', response.status, response.statusText);
+            setDebugInfo(prev => [...prev.slice(-5), `Response: ${response.status} ${response.statusText}`]);
+          }
+          return response;
+        })
+        .catch(error => {
+          if (typeof url === 'string' && url.includes('geoportal.gov.pl')) {
+            console.error('Geoportal error:', error);
+            setDebugInfo(prev => [...prev.slice(-5), `Error: ${error.message}`]);
+          }
+          throw error;
+        });
+    };
+
+    return () => {
+      window.fetch = originalFetch;
+    };
+  }, []);
+
+  const { BaseLayer } = LayersControl;
+
+  if (!mapLoaded) {
+    return <div>Loading improved map...</div>;
+  }
+
+  return (
+    <div style={{ height: '100%', width: '100%' }}>
+      {/* Debug Info Panel */}
+      <div style={{ 
+        position: 'absolute', 
+        top: '10px', 
+        left: '10px', 
+        background: 'rgba(255,255,255,0.95)', 
+        padding: '10px', 
+        maxWidth: '400px', 
+        maxHeight: '150px', 
+        overflow: 'auto', 
+        zIndex: 1000,
+        fontSize: '11px',
+        borderRadius: '5px',
+        boxShadow: '0 2px 5px rgba(0,0,0,0.2)'
+      }}>
+        <strong>WMTS Debug Info:</strong>
+        {debugInfo.map((info, index) => (
+          <div key={index} style={{ marginTop: '2px', wordBreak: 'break-all' }}>
+            {info}
+          </div>
+        ))}
+      </div>
+
+      <MapContainer 
+        center={center} 
+        zoom={zoom} 
+        style={{ height: '100%', width: '100%' }}
+        scrollWheelZoom={true}
+      >
+        <LayersControl position="topright">
+          {/* Working reference layer */}
+          <BaseLayer checked name="Google Satellite (Working Reference)">
+            <GoogleSatelliteLayer />
+          </BaseLayer>
+
+          <BaseLayer name="OpenStreetMap">
+            <TileLayer
+              attribution='&copy; <a href="https://www.openstreetmap.org/copyright">OpenStreetMap</a> contributors'
+              url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
+              maxZoom={19}
+            />
+          </BaseLayer>
+
+          {/* WMTS layers with custom implementation */}
+          <BaseLayer name="Polish WMTS (EPSG:3857, JPEG)">
+            <PolishWMTSLayer tilematrixSet="EPSG:3857" format="image/jpeg" />
+          </BaseLayer>
+
+          <BaseLayer name="Polish WMTS (EPSG:3857, PNG)">
+            <PolishWMTSLayer tilematrixSet="EPSG:3857" format="image/png" />
+          </BaseLayer>
+
+          <BaseLayer name="Polish WMTS (EPSG:4326, JPEG)">
+            <PolishWMTSLayer tilematrixSet="EPSG:4326" format="image/jpeg" />
+          </BaseLayer>
+
+          <BaseLayer name="Polish WMTS (EPSG:2180, JPEG)">
+            <PolishWMTSLayer tilematrixSet="EPSG:2180" format="image/jpeg" />
+          </BaseLayer>
+        </LayersControl>
+
+        {markers.map((marker, index) => (
+          <Marker key={index} position={marker.position}>
+            {marker.popup && <Popup>{marker.popup}</Popup>}
+          </Marker>
+        ))}
+      </MapContainer>
+    </div>
+  );
+}
--- a/src/components/ui/LeafletMap.js
+++ b/src/components/ui/LeafletMap.js
@@ -3,6 +3,7 @@
 import {
 	MapContainer,
 	TileLayer,
+	WMSTileLayer,
 	Marker,
 	Popup,
 	LayersControl,
@@ -80,8 +81,7 @@ export default function EnhancedLeafletMap({
 	useEffect(() => {
 		fixLeafletIcons();
 	}, []);
-
-	const { BaseLayer } = LayersControl;
+	const { BaseLayer, Overlay } = LayersControl;
 	return (
 		<MapContainer
 			center={center}
@@ -94,6 +94,7 @@ export default function EnhancedLeafletMap({
 			
 			{showLayerControl ? (
 				<LayersControl position="topright">
+					{/* Base Layers */}
 					{mapLayers.base.map((layer, index) => (
 						<BaseLayer
 							key={index}
@@ -107,6 +108,32 @@ export default function EnhancedLeafletMap({
 								tileSize={layer.tileSize || 256}
 							/>
 						</BaseLayer>
+					))}
+							{/* Overlay Layers */}
+					{mapLayers.overlays && mapLayers.overlays.map((layer, index) => (
+						<Overlay
+							key={`overlay-${index}`}
+							checked={layer.checked}
+							name={layer.name}
+						>
+							{layer.type === "wms" ? (
+								<WMSTileLayer
+									attribution={layer.attribution}
+									url={layer.url}
+									params={layer.params}
+									format={layer.params.format}
+									transparent={layer.params.transparent}
+									opacity={layer.opacity}
+								/>
+							) : (
+								<TileLayer
+									attribution={layer.attribution}
+									url={layer.url}
+									maxZoom={layer.maxZoom}
+									opacity={layer.opacity}
+								/>
+							)}
+						</Overlay>
 					))}
 				</LayersControl>
 			) : (
--- a/src/components/ui/PolishGeoLayers.js
+++ b/src/components/ui/PolishGeoLayers.js
@@ -0,0 +1,271 @@
+"use client";
+
+import { WMSTileLayer, TileLayer } from 'react-leaflet';
+
+// Collection of all Polish geospatial layers from your OpenLayers implementation
+// These can be imported individually and used in any map component
+
+// 1. Polish Orthophoto Layers (WMTS)
+export function PolishOrthophotoStandard() {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+export function PolishOrthophotoHighRes() {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/HighResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+    />
+  );
+}
+
+// 2. Polish Government WMS Layers - All transparent overlays
+export function PolishCadastralData() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://www.gugik.gov.pl/">GUGiK</a>'
+      url="https://integracja01.gugik.gov.pl/cgi-bin/KrajowaIntegracjaEwidencjiGruntow"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'powiaty,powiaty_obreby,zsin,obreby,dzialki,geoportal,numery_dzialek,budynki',
+        styles: ',,,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857'
+      }}
+      format="image/png"
+      transparent={true}
+      opacity={0.8} // Semi-transparent overlay for property boundaries
+    />
+  );
+}
+
+export function PolishSpatialPlanning() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/ext/KrajowaIntegracjaMiejscowychPlanowZagospodarowaniaPrzestrzennego"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'raster,wektor-str,wektor-lzb,wektor-pow,wektor-lin,wektor-pkt,granice',
+        styles: ',,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        tiled: true
+      }}
+      format="image/png"
+      transparent={true}
+      opacity={0.7} // Semi-transparent overlay for planning zones
+    />
+  );
+}
+
+// 3. LP-Portal Municipal Layers - Transparent overlays with different opacity levels
+export function LPPortalRoads() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_6_mapainteraktywna_drogi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+      opacity={0.9} // Mostly opaque for road visibility
+    />
+  );
+}
+
+export function LPPortalStreetNames() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_5_mapainteraktywna_opisy_drog,00_3_mapainteraktywna_nazwy_ulic',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+      opacity={1.0} // Fully opaque for text readability
+    />
+  );
+}
+
+export function LPPortalParcels() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'dzialki',
+        styles: '',
+        format: 'image/png',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        tiled: true
+      }}
+      format="image/png"
+      transparent={true}
+      opacity={0.6} // Semi-transparent for parcel boundaries
+    />
+  );
+}
+
+export function LPPortalSurveyMarkers() {
+  return (
+    <WMSTileLayer
+      attribution='&copy; <a href="https://lp-portal.pl/">LP-Portal</a>'
+      url="https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms"
+      params={{
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_2_view_geop_odcinek_pikietaz_glob_multi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        tiled: true
+      }}
+      format="image/png8"
+      transparent={true}
+      opacity={0.8} // Semi-transparent for survey markers
+    />
+  );
+}
+
+// 4. Utility Google Maps Layers for comparison
+export function GoogleSatellite() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+export function GoogleRoads() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=h&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+// Layer configuration for easy integration with transparency settings
+export const polishLayerConfigs = {
+  base: [
+    {
+      name: "Polish Orthophoto (Standard)",
+      component: PolishOrthophotoStandard,
+      description: "High-quality aerial imagery from Polish Geoportal",
+      opacity: 1.0,
+      transparent: false
+    },
+    {
+      name: "Polish Orthophoto (High Resolution)",
+      component: PolishOrthophotoHighRes,
+      description: "Ultra-high resolution aerial imagery",
+      opacity: 1.0,
+      transparent: false
+    },
+    {
+      name: "Google Satellite",
+      component: GoogleSatellite,
+      description: "Google satellite imagery for comparison",
+      opacity: 1.0,
+      transparent: false
+    },
+    {
+      name: "Google Roads",
+      component: GoogleRoads,
+      description: "Google road overlay",
+      opacity: 1.0,
+      transparent: false
+    }
+  ],
+  overlays: [
+    {
+      name: "📋 Polish Cadastral Data",
+      component: PolishCadastralData,
+      description: "Property boundaries and parcel information",
+      opacity: 0.8,
+      transparent: true,
+      category: "government"
+    },
+    {
+      name: "🏗️ Polish Spatial Planning",
+      component: PolishSpatialPlanning,
+      description: "Zoning and urban planning data",
+      opacity: 0.7,
+      transparent: true,
+      category: "government"
+    },
+    {
+      name: "🛣️ LP-Portal Roads",
+      component: LPPortalRoads,
+      description: "Detailed road network",
+      opacity: 0.9,
+      transparent: true,
+      category: "municipal"
+    },
+    {
+      name: "🏷️ LP-Portal Street Names",
+      component: LPPortalStreetNames,
+      description: "Street names and descriptions",
+      opacity: 1.0,
+      transparent: true,
+      category: "municipal"
+    },
+    {
+      name: "📐 LP-Portal Parcels",
+      component: LPPortalParcels,
+      description: "Municipal property parcels",
+      opacity: 0.6,
+      transparent: true,
+      category: "municipal"
+    },
+    {
+      name: "📍 LP-Portal Survey Markers",
+      component: LPPortalSurveyMarkers,
+      description: "Survey markers and reference points",
+      opacity: 0.8,
+      transparent: true,
+      category: "municipal"
+    }
+  ]
+};
--- a/src/components/ui/PolishOrthophotoMap.js
+++ b/src/components/ui/PolishOrthophotoMap.js
@@ -0,0 +1,126 @@
+"use client";
+
+import { MapContainer, TileLayer, Marker, Popup, LayersControl } from 'react-leaflet';
+import 'leaflet/dist/leaflet.css';
+import { useEffect, useState } from 'react';
+import proj4 from 'proj4';
+
+// Define Polish coordinate system EPSG:2180
+proj4.defs("EPSG:2180", "+proj=tmerc +lat_0=0 +lon_0=19 +k=0.9993 +x_0=500000 +y_0=-5300000 +ellps=GRS80 +towgs84=0,0,0,0,0,0,0 +units=m +no_defs +type=crs");
+
+// Fix for default markers in react-leaflet
+const fixLeafletIcons = () => {
+  if (typeof window !== 'undefined') {
+    const L = require('leaflet');
+    
+    delete L.Icon.Default.prototype._getIconUrl;
+    L.Icon.Default.mergeOptions({
+      iconRetinaUrl: '/leaflet/marker-icon-2x.png',
+      iconUrl: '/leaflet/marker-icon.png',
+      shadowUrl: '/leaflet/marker-shadow.png',
+    });
+  }
+};
+
+// Custom tile layer component for Polish Geoportal - WORKING VERSION
+function PolishOrthophotoLayer({ visible = true }) {
+  return (
+    <TileLayer
+      attribution='&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>'
+      url="https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg"
+      maxZoom={19}
+      key="polish-orthophoto"
+    />
+  );
+}
+
+// Google Maps layers as alternatives
+function GoogleSatelliteLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+function GoogleRoadsLayer() {
+  return (
+    <TileLayer
+      attribution='&copy; Google'
+      url="http://mt1.google.com/vt/lyrs=h&hl=pl&x={x}&y={y}&z={z}"
+      maxZoom={20}
+    />
+  );
+}
+
+export default function PolishOrthophotoMap({ 
+  center = [50.0647, 19.9450], // Default to Krakow, Poland
+  zoom = 13, 
+  markers = [], 
+  showLayerControl = true 
+}) {
+  const [mapLoaded, setMapLoaded] = useState(false);
+
+  useEffect(() => {
+    fixLeafletIcons();
+    setMapLoaded(true);
+  }, []);
+
+  const { BaseLayer } = LayersControl;
+
+  if (!mapLoaded) {
+    return <div>Loading map...</div>;
+  }
+
+  return (
+    <MapContainer 
+      center={center} 
+      zoom={zoom} 
+      style={{ height: '100%', width: '100%' }}
+      scrollWheelZoom={true}
+    >
+      {showLayerControl ? (
+        <LayersControl position="topright">
+          <BaseLayer name="OpenStreetMap">
+            <TileLayer
+              attribution='&copy; <a href="https://www.openstreetmap.org/copyright">OpenStreetMap</a> contributors'
+              url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
+              maxZoom={19}
+            />
+          </BaseLayer>
+          
+          <BaseLayer checked name="Polish Geoportal Orthophoto">
+            <PolishOrthophotoLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Satellite">
+            <GoogleSatelliteLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Google Roads">
+            <GoogleRoadsLayer />
+          </BaseLayer>
+
+          <BaseLayer name="Esri Satellite">
+            <TileLayer
+              attribution='&copy; <a href="https://www.esri.com/">Esri</a> &mdash; Source: Esri, i-cubed, USDA, USGS, AEX, GeoEye, Getmapping, Aerogrid, IGN, IGP, UPR-EGP, and the GIS User Community'
+              url="https://server.arcgisonline.com/ArcGIS/rest/services/World_Imagery/MapServer/tile/{z}/{y}/{x}"
+              maxZoom={19}
+            />
+          </BaseLayer>
+        </LayersControl>
+      ) : (
+        // Default to Polish orthophoto when no layer control
+        <PolishOrthophotoLayer />
+      )}
+
+      {markers.map((marker, index) => (
+        <Marker key={index} position={marker.position}>
+          {marker.popup && <Popup>{marker.popup}</Popup>}
+        </Marker>
+      ))}
+    </MapContainer>
+  );
+}
--- a/src/components/ui/TransparencyDemoMap.js
+++ b/src/components/ui/TransparencyDemoMap.js
@@ -0,0 +1,166 @@
+"use client";
+
+import { useState } from 'react';
+import { MapContainer, TileLayer, LayersControl } from 'react-leaflet';
+import 'leaflet/dist/leaflet.css';
+import { 
+  PolishOrthophotoStandard,
+  PolishCadastralData,
+  PolishSpatialPlanning,
+  LPPortalRoads,
+  LPPortalStreetNames,
+  LPPortalParcels
+} from './PolishGeoLayers';
+
+// Custom layer with adjustable opacity
+function AdjustableOpacityLayer({ children, opacity = 1.0 }) {
+  return React.cloneElement(children, { opacity });
+}
+
+export default function TransparencyDemoMap({ 
+  center = [50.0647, 19.9450],
+  zoom = 15
+}) {
+  const [opacitySettings, setOpacitySettings] = useState({
+    cadastral: 0.8,
+    planning: 0.7,
+    roads: 0.9,
+    streetNames: 1.0,
+    parcels: 0.6
+  });
+
+  const { BaseLayer, Overlay } = LayersControl;
+
+  const updateOpacity = (layer, value) => {
+    setOpacitySettings(prev => ({
+      ...prev,
+      [layer]: value / 100
+    }));
+  };
+
+  return (
+    <div className="h-full">
+      {/* Opacity Controls */}
+      <div className="absolute top-4 left-4 z-[1000] bg-white p-4 rounded-lg shadow-lg max-w-xs">
+        <h3 className="font-semibold mb-3">🎨 Layer Transparency Controls</h3>
+        <div className="space-y-3 text-sm">
+          <div>
+            <label className="block text-gray-700 mb-1">📋 Cadastral Data</label>
+            <input
+              type="range"
+              min="0"
+              max="100"
+              value={opacitySettings.cadastral * 100}
+              onChange={(e) => updateOpacity('cadastral', e.target.value)}
+              className="w-full"
+            />
+            <span className="text-xs text-gray-500">{Math.round(opacitySettings.cadastral * 100)}%</span>
+          </div>
+          
+          <div>
+            <label className="block text-gray-700 mb-1">🏗️ Spatial Planning</label>
+            <input
+              type="range"
+              min="0"
+              max="100"
+              value={opacitySettings.planning * 100}
+              onChange={(e) => updateOpacity('planning', e.target.value)}
+              className="w-full"
+            />
+            <span className="text-xs text-gray-500">{Math.round(opacitySettings.planning * 100)}%</span>
+          </div>
+          
+          <div>
+            <label className="block text-gray-700 mb-1">🛣️ Roads</label>
+            <input
+              type="range"
+              min="0"
+              max="100"
+              value={opacitySettings.roads * 100}
+              onChange={(e) => updateOpacity('roads', e.target.value)}
+              className="w-full"
+            />
+            <span className="text-xs text-gray-500">{Math.round(opacitySettings.roads * 100)}%</span>
+          </div>
+          
+          <div>
+            <label className="block text-gray-700 mb-1">🏷️ Street Names</label>
+            <input
+              type="range"
+              min="0"
+              max="100"
+              value={opacitySettings.streetNames * 100}
+              onChange={(e) => updateOpacity('streetNames', e.target.value)}
+              className="w-full"
+            />
+            <span className="text-xs text-gray-500">{Math.round(opacitySettings.streetNames * 100)}%</span>
+          </div>
+          
+          <div>
+            <label className="block text-gray-700 mb-1">📐 Parcels</label>
+            <input
+              type="range"
+              min="0"
+              max="100"
+              value={opacitySettings.parcels * 100}
+              onChange={(e) => updateOpacity('parcels', e.target.value)}
+              className="w-full"
+            />
+            <span className="text-xs text-gray-500">{Math.round(opacitySettings.parcels * 100)}%</span>
+          </div>
+        </div>
+      </div>
+
+      <MapContainer 
+        center={center} 
+        zoom={zoom} 
+        style={{ height: '100%', width: '100%' }}
+        scrollWheelZoom={true}
+      >
+        <LayersControl position="topright">
+          <BaseLayer checked name="Polish Orthophoto">
+            <PolishOrthophotoStandard />
+          </BaseLayer>
+
+          <BaseLayer name="OpenStreetMap">
+            <TileLayer
+              attribution='&copy; <a href="https://www.openstreetmap.org/copyright">OpenStreetMap</a> contributors'
+              url="https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png"
+              maxZoom={19}
+            />
+          </BaseLayer>
+
+          <Overlay name="📋 Cadastral Data (Adjustable)">
+            <AdjustableOpacityLayer opacity={opacitySettings.cadastral}>
+              <PolishCadastralData />
+            </AdjustableOpacityLayer>
+          </Overlay>
+
+          <Overlay name="🏗️ Spatial Planning (Adjustable)">
+            <AdjustableOpacityLayer opacity={opacitySettings.planning}>
+              <PolishSpatialPlanning />
+            </AdjustableOpacityLayer>
+          </Overlay>
+
+          <Overlay name="🛣️ Roads (Adjustable)">
+            <AdjustableOpacityLayer opacity={opacitySettings.roads}>
+              <LPPortalRoads />
+            </AdjustableOpacityLayer>
+          </Overlay>
+
+          <Overlay name="🏷️ Street Names (Adjustable)">
+            <AdjustableOpacityLayer opacity={opacitySettings.streetNames}>
+              <LPPortalStreetNames />
+            </AdjustableOpacityLayer>
+          </Overlay>
+
+          <Overlay name="📐 Parcels (Adjustable)">
+            <AdjustableOpacityLayer opacity={opacitySettings.parcels}>
+              <LPPortalParcels />
+            </AdjustableOpacityLayer>
+          </Overlay>
+        </LayersControl>
+      </MapContainer>
+    </div>
+  );
+}
--- a/src/components/ui/WMTSLayer.js
+++ b/src/components/ui/WMTSLayer.js
@@ -0,0 +1,156 @@
+"use client";
+
+import { useEffect, useRef } from 'react';
+import { useMap } from 'react-leaflet';
+
+// Custom WMTS Layer for Polish Geoportal
+export function WMTSLayer({ 
+  url, 
+  layer, 
+  style = 'default', 
+  tilematrixSet = 'EPSG:3857', 
+  format = 'image/jpeg',
+  attribution = '',
+  maxZoom = 19
+}) {
+  const map = useMap();
+  const layerRef = useRef(null);
+
+  useEffect(() => {
+    if (typeof window !== 'undefined') {
+      const L = require('leaflet');
+      
+      // Custom WMTS layer that builds proper KVP URLs
+      const WMTSTileLayer = L.TileLayer.extend({
+        getTileUrl: function(coords) {
+          const tilematrix = tilematrixSet === 'EPSG:2180' ? `EPSG:2180:${coords.z}` : coords.z;
+          
+          const params = new URLSearchParams({
+            SERVICE: 'WMTS',
+            REQUEST: 'GetTile',
+            VERSION: '1.0.0',
+            LAYER: layer,
+            STYLE: style,
+            TILEMATRIXSET: tilematrixSet,
+            TILEMATRIX: tilematrix,
+            TILEROW: coords.y,
+            TILECOL: coords.x,
+            FORMAT: format
+          });
+          
+          return `${url}?${params.toString()}`;
+        }
+      });
+
+      // Create the layer
+      layerRef.current = new WMTSTileLayer('', {
+        attribution: attribution,
+        maxZoom: maxZoom,
+        tileSize: 256
+      });
+
+      // Add to map
+      map.addLayer(layerRef.current);
+    }
+
+    // Cleanup
+    return () => {
+      if (layerRef.current && map) {
+        map.removeLayer(layerRef.current);
+      }
+    };
+  }, [map, url, layer, style, tilematrixSet, format, attribution, maxZoom]);
+
+  return null;
+}
+
+// Proj4Leaflet WMTS Layer for Polish projection
+export function Proj4WMTSLayer({ 
+  url, 
+  layer, 
+  style = 'default', 
+  tilematrixSet = 'EPSG:2180', 
+  format = 'image/jpeg',
+  attribution = '',
+  maxZoom = 16
+}) {
+  const map = useMap();
+  const layerRef = useRef(null);
+
+  useEffect(() => {
+    if (typeof window !== 'undefined') {
+      const L = require('leaflet');
+      const proj4 = require('proj4');
+      require('proj4leaflet');
+      
+      // Define Polish projection
+      proj4.defs("EPSG:2180", "+proj=tmerc +lat_0=0 +lon_0=19 +k=0.9993 +x_0=500000 +y_0=-5300000 +ellps=GRS80 +towgs84=0,0,0,0,0,0,0 +units=m +no_defs +type=crs");
+      
+      // Create CRS for EPSG:2180
+      const crs2180 = new L.Proj.CRS('EPSG:2180', proj4.defs('EPSG:2180'), {
+        resolutions: [
+          2116.6709 * 4,
+          2116.6709 * 2,
+          2116.6709,
+          1058.33545,
+          529.167725,
+          264.5838625,
+          132.29193125,
+          66.145965625,
+          26.458386249999997,
+          13.229193124999998,
+          6.614596562499999,
+          2.645838625,
+          1.3229193125,
+          0.529167725,
+          0.2645838625,
+          0.13229193125,
+          0.13229193125 / 2,
+        ],
+        origin: [100000, 850000],
+        bounds: L.bounds([144907.16581514146, 129171.69217334315], [890379.1658151413, 812697.4119729949])
+      });
+
+      // Custom WMTS layer
+      const WMTSTileLayer = L.TileLayer.extend({
+        getTileUrl: function(coords) {
+          const tilematrix = `EPSG:2180:${coords.z}`;
+          
+          const params = new URLSearchParams({
+            SERVICE: 'WMTS',
+            REQUEST: 'GetTile',
+            VERSION: '1.0.0',
+            LAYER: layer,
+            STYLE: style,
+            TILEMATRIXSET: tilematrixSet,
+            TILEMATRIX: tilematrix,
+            TILEROW: coords.y,
+            TILECOL: coords.x,
+            FORMAT: format
+          });
+          
+          return `${url}?${params.toString()}`;
+        }
+      });
+
+      // Create the layer
+      layerRef.current = new WMTSTileLayer('', {
+        attribution: attribution,
+        maxZoom: maxZoom,
+        tileSize: 512
+      });
+
+      // Add to map (but this won't work properly with EPSG:3857 map)
+      // This is more for demonstration - would need to change map CRS
+      map.addLayer(layerRef.current);
+    }
+
+    return () => {
+      if (layerRef.current && map) {
+        map.removeLayer(layerRef.current);
+      }
+    };
+  }, [map, url, layer, style, tilematrixSet, format, attribution, maxZoom]);
+
+  return null;
+}
--- a/src/components/ui/mapLayers.js
+++ b/src/components/ui/mapLayers.js
@@ -13,14 +13,32 @@ export const mapLayers = {
      url: "https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png",
      maxZoom: 19
    },
-    polishOrthophoto,
    {
-      name: "Polish Land Records (WMS)",
-      attribution: '&copy; <a href="https://www.gugik.gov.pl/">GUGiK</a>',
-      // This is actually a WMS service, not WMTS as discovered from GetCapabilities
-      url: "https://integracja.gugik.gov.pl/cgi-bin/KrajowaIntegracjaEwidencjiGruntow?SERVICE=WMS&VERSION=1.3.0&REQUEST=GetMap&BBOX={bbox-epsg-3857}&CRS=EPSG:3857&WIDTH=256&HEIGHT=256&LAYERS=EGiB&STYLES=&FORMAT=image/png",
+      name: "🇵🇱 Polish Orthophoto (Standard)",
+      attribution: '&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>',
+      url: "https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg",
      maxZoom: 19,
-      tileSize: 256
+      checked: false
+    },
+    {
+      name: "🇵🇱 Polish Orthophoto (High Resolution)",
+      attribution: '&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>',
+      url: "https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/HighResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg",
+      maxZoom: 19,
+      checked: false
+    },
+    {
+      name: "🌍 Google Satellite",
+      attribution: '&copy; Google',
+      url: "http://mt1.google.com/vt/lyrs=s&hl=pl&x={x}&y={y}&z={z}",
+      maxZoom: 20,
+      checked: false
+    },    {
+      name: "🌍 Google Hybrid",
+      attribution: '&copy; Google',
+      url: "http://mt1.google.com/vt/lyrs=y&hl=pl&x={x}&y={y}&z={z}",
+      maxZoom: 20,
+      checked: false
    },
    {
      name: "Satellite (Esri)",
@@ -34,7 +52,131 @@ export const mapLayers = {
      url: "https://{s}.basemaps.cartocdn.com/rastertiles/voyager/{z}/{x}/{y}{r}.png",
      maxZoom: 19
    }
-  ].filter(Boolean) // Remove any null entries
+  ].filter(Boolean), // Remove any null entries
+    overlays: [
+    {
+      name: "🌍 Google Roads",
+      type: "tile",
+      attribution: '&copy; Google',
+      url: "http://mt1.google.com/vt/lyrs=h&hl=pl&x={x}&y={y}&z={z}",
+      maxZoom: 20,
+      opacity: 1.0,
+      checked: false
+    },
+    {
+      name: "📋 Polish Cadastral Data",
+      type: "wms",
+      attribution: '&copy; <a href="https://www.gugik.gov.pl/">GUGiK</a>',
+      url: "https://integracja01.gugik.gov.pl/cgi-bin/KrajowaIntegracjaEwidencjiGruntow",
+      params: {
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'powiaty,powiaty_obreby,zsin,obreby,dzialki,geoportal,numery_dzialek,budynki',
+        styles: ',,,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857'
+      },
+      opacity: 0.8,
+      checked: false
+    },
+    {
+      name: "🏗️ Polish Spatial Planning",
+      type: "wms",
+      attribution: '&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>',
+      url: "https://mapy.geoportal.gov.pl/wss/ext/KrajowaIntegracjaMiejscowychPlanowZagospodarowaniaPrzestrzennego",
+      params: {
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'raster,wektor-str,wektor-lzb,wektor-pow,wektor-lin,wektor-pkt,granice',
+        styles: ',,,,,,',
+        format: 'image/png',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        tiled: true
+      },
+      opacity: 0.7,
+      checked: false
+    },
+    {
+      name: "🛣️ LP-Portal Roads",
+      type: "wms",
+      attribution: '&copy; <a href="https://lp-portal.pl/">LP-Portal</a>',
+      url: "https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms",
+      params: {
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_6_mapainteraktywna_drogi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.3.0',
+        crs: 'EPSG:3857',
+        tiled: true
+      },
+      opacity: 0.9,
+      checked: false
+    },
+    {
+      name: "🏷️ LP-Portal Street Names",
+      type: "wms",
+      attribution: '&copy; <a href="https://lp-portal.pl/">LP-Portal</a>',
+      url: "https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms",
+      params: {
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_5_mapainteraktywna_opisy_drog,00_3_mapainteraktywna_nazwy_ulic',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        tiled: true
+      },
+      opacity: 1.0,
+      checked: false
+    },
+    {
+      name: "📐 LP-Portal Parcels",
+      type: "wms",
+      attribution: '&copy; <a href="https://lp-portal.pl/">LP-Portal</a>',
+      url: "https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms",
+      params: {
+        service: 'WMS',
+        request: 'GetMap',
+        layers: 'dzialki',
+        styles: '',
+        format: 'image/png',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        tiled: true
+      },
+      opacity: 0.6,
+      checked: false
+    },
+    {
+      name: "📍 LP-Portal Survey Markers",
+      type: "wms",
+      attribution: '&copy; <a href="https://lp-portal.pl/">LP-Portal</a>',
+      url: "https://geoserver.lp-portal.pl/geoserver/pzdnowysacz/wms",
+      params: {
+        service: 'WMS',
+        request: 'GetMap',
+        layers: '00_2_view_geop_odcinek_pikietaz_glob_multi',
+        styles: '',
+        format: 'image/png8',
+        transparent: true,
+        version: '1.1.1',
+        crs: 'EPSG:3857',
+        tiled: true
+      },
+      opacity: 0.8,
+      checked: false
+    }
+  ]
 };

 // WMTS services configuration with GetCapabilities URLs
--- a/src/components/ui/wmtsCapabilities.js
+++ b/src/components/ui/wmtsCapabilities.js
@@ -53,13 +53,15 @@ export function buildWMTSTileUrl(config) {
 export const polishWMTSServices = {
  orthophoto: {
    name: "Polish Geoportal Orthophoto",
-    capabilitiesUrl: "https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution",
+    capabilitiesUrl: "https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/REST/StandardResolution",
    layer: "ORTO",
    style: "default",
-    tilematrixSet: "EPSG:2180",
-    format: "image/jpeg",
+    tilematrixSet: "EPSG:3857", // Changed from EPSG:2180 to EPSG:3857 for better Leaflet compatibility
+    format: "image/png", // Changed from jpeg to png
    attribution: '&copy; <a href="https://www.geoportal.gov.pl/">Geoportal</a>',
-    maxZoom: 19
+    maxZoom: 19,
+    tileSize: 512,
+    zoomOffset: -1
  }
 };

@@ -75,14 +77,10 @@ export function generateLayerConfig(serviceName) {
  return {
    name: service.name,
    attribution: service.attribution,
-    url: buildWMTSTileUrl({
-      baseUrl: service.capabilitiesUrl,
-      layer: service.layer,
-      style: service.style,
-      tilematrixSet: service.tilematrixSet,
-      format: service.format
-    }),
+    // Use working WMTS KVP URL format
+    url: "https://mapy.geoportal.gov.pl/wss/service/PZGIK/ORTO/WMTS/StandardResolution?SERVICE=WMTS&REQUEST=GetTile&VERSION=1.0.0&LAYER=ORTO&STYLE=default&TILEMATRIXSET=EPSG:3857&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}&FORMAT=image/jpeg",
    maxZoom: service.maxZoom,
-    tileSize: 256
+    tileSize: 256, // Standard tile size for WMTS
+    checked: false
  };
 }